About 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid
2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid (PubChem CID 135484993) has the molecular formula C7H14N5O5P
and a molecular weight of 279.19 g/mol. Its IUPAC name is 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid.
Molecular Properties
| Compound Name | 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid |
| PubChem CID | 135484993 |
| Molecular Formula | C7H14N5O5P |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid |
| SMILES | Nc1nc(NCCOCP(=O)(O)O)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C7H14N5O5P/c8-4-5(11-7(9)12-6(4)13)10-1-2-17-3-18(14,15)16/h1-3,8H2,(H2,14,15,16)(H4,9,10,11,12,13) |
| InChIKey | OQZJUTCBVYTWKE-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid?
The IUPAC name of 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid (CID 135484993) is 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid.
What is the SMILES notation for 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid?
The canonical SMILES for 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid is Nc1nc(NCCOCP(=O)(O)O)c(N)c(=O)[nH]1.
What is the InChIKey of 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid?
The InChIKey is OQZJUTCBVYTWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N5O5P/c8-4-5(11-7(9)12-6(4)13)10-1-2-17-3-18(14,15)16/h1-3,8H2,(H2,14,15,16)(H4,9,10,11,12,13).
What are the key properties of 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid?
2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid has a molecular weight of 279.19 g/mol, XLogP of -1.50, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]ethoxymethylphosphonic acid is sourced from PubChem (CID 135484993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).