About 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one
3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one (PubChem CID 135485031) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one |
| PubChem CID | 135485031 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one |
| SMILES | COc1ccc(OC)c(/N=C/c2c(O)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C18H15NO5/c1-22-11-7-8-16(23-2)14(9-11)19-10-13-17(20)12-5-3-4-6-15(12)24-18(13)21/h3-10,20H,1-2H3/b19-10+ |
| InChIKey | VAYSEXFMPFYOTL-VXLYETTFSA-N |
| XLogP | 3.27 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one?
The IUPAC name of 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one (CID 135485031) is 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one.
What is the SMILES notation for 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one?
The canonical SMILES for 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one is COc1ccc(OC)c(/N=C/c2c(O)c3ccccc3oc2=O)c1.
What is the InChIKey of 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one?
The InChIKey is VAYSEXFMPFYOTL-VXLYETTFSA-N. The full InChI is InChI=1S/C18H15NO5/c1-22-11-7-8-16(23-2)14(9-11)19-10-13-17(20)12-5-3-4-6-15(12)24-18(13)21/h3-10,20H,1-2H3/b19-10+.
What are the key properties of 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one?
3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one has a molecular weight of 325.32 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethoxyphenyl)iminomethyl]-4-hydroxychromen-2-one is sourced from PubChem (CID 135485031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).