C20H15NO7 — CID 135485032
dimethyl 5-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 135485032) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is dimethyl 5-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135485032 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | dimethyl 5-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2c(O)c3ccccc3oc2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H15NO7/c1-26-18(23)11-7-12(19(24)27-2)9-13(8-11)21-10-15-17(22)14-5-3-4-6-16(14)28-20(15)25/h3-10,22H,1-2H3/b21-10+ |
| InChIKey | LZPHDLVSRSSQDN-UFFVCSGVSA-N |
| XLogP | 2.82 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|