C18H11F5N4O3 — CID 135485053
1-benzyl-6-hydroxy-5-[(E)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione (PubChem CID 135485053) has the molecular formula C18H11F5N4O3 and a molecular weight of 426.30 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-5-[(E)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-hydroxy-5-[(E)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135485053 |
| Molecular Formula | C18H11F5N4O3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 1-benzyl-6-hydroxy-5-[(E)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c(O)c1/C=N/Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H11F5N4O3/c19-10-11(20)13(22)15(14(23)12(10)21)26-24-6-9-16(28)25-18(30)27(17(9)29)7-8-4-2-1-3-5-8/h1-6,26,29H,7H2,(H,25,28,30)/b24-6+ |
| InChIKey | IHMOUQMLJFEVBO-GFXGDVFHSA-N |
| XLogP | 2.43 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|