C8H4F8N2O — CID 135485181
2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135485181) has the molecular formula C8H4F8N2O and a molecular weight of 296.12 g/mol. Its IUPAC name is 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135485181 |
| Molecular Formula | C8H4F8N2O |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H4F8N2O/c1-2-17-4(6(9,10)8(14,15)16)3(5(19)18-2)7(11,12)13/h1H3,(H,17,18,19) |
| InChIKey | HKSUCMKVRZEKEO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|