C18H19ClN4O2S — CID 135485338
ethyl 5-[2-(3-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 135485338) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is ethyl 5-[2-(3-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(3-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135485338 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | ethyl 5-[2-(3-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C2=NN/C(=N/c3cccc(Cl)c3)SC2)c1C |
| InChI | InChI=1S/C18H19ClN4O2S/c1-4-25-17(24)15-10(2)16(20-11(15)3)14-9-26-18(23-22-14)21-13-7-5-6-12(19)8-13/h5-8,20H,4,9H2,1-3H3,(H,21,23) |
| InChIKey | RNMBUROXTFEIFD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|