About (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione
(6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione (PubChem CID 135485446) has the molecular formula C4H6N4O2
and a molecular weight of 142.12 g/mol. Its IUPAC name is (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione |
| PubChem CID | 135485446 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione |
| SMILES | N/N=C1/CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C4H6N4O2/c5-8-2-1-3(9)7-4(10)6-2/h1,5H2,(H2,6,7,8,9,10) |
| InChIKey | QGIANYJQIJBTRC-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione?
The IUPAC name of (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione (CID 135485446) is (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione.
What is the SMILES notation for (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione?
The canonical SMILES for (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione is N/N=C1/CC(=O)NC(=O)N1.
What is the InChIKey of (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione?
The InChIKey is QGIANYJQIJBTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2/c5-8-2-1-3(9)7-4(10)6-2/h1,5H2,(H2,6,7,8,9,10).
What are the key properties of (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione?
(6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione has a molecular weight of 142.12 g/mol, XLogP of -1.51, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-hydrazinylidene-1,3-diazinane-2,4-dione is sourced from PubChem (CID 135485446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).