C19H25N3O4 — CID 135485733
4-(cyclohexyliminomethyl)-5-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 135485733) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(cyclohexyliminomethyl)-5-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-(cyclohexyliminomethyl)-5-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135485733 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-(cyclohexyliminomethyl)-5-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | COc1cc(-c2[nH][nH]c(=O)c2/C=N/C2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H25N3O4/c1-24-15-9-12(10-16(25-2)18(15)26-3)17-14(19(23)22-21-17)11-20-13-7-5-4-6-8-13/h9-11,13H,4-8H2,1-3H3,(H2,21,22,23)/b20-11+ |
| InChIKey | WYVBFCZRMNTAEO-RGVLZGJSSA-N |
| XLogP | 3.15 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|