C50H64N4O4 — CID 135485755
3-(4-tert-butylanilino)-10-(4-tert-butylphenyl)imino-14-hydroxy-6,13-dioctyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),8,11(15)-pentaene-5,7,12-trione (PubChem CID 135485755) has the molecular formula C50H64N4O4 and a molecular weight of 785.09 g/mol. Its IUPAC name is 3-(4-tert-butylanilino)-10-(4-tert-butylphenyl)imino-14-hydroxy-6,13-dioctyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),8,11(15)-pentaene-5,7,12-trione.
| Compound Name | 3-(4-tert-butylanilino)-10-(4-tert-butylphenyl)imino-14-hydroxy-6,13-dioctyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),8,11(15)-pentaene-5,7,12-trione |
|---|---|
| PubChem CID | 135485755 |
| Molecular Formula | C50H64N4O4 |
| Molecular Weight | 785.09 g/mol |
| Exact Mass | 784.49 |
| IUPAC Name | 3-(4-tert-butylanilino)-10-(4-tert-butylphenyl)imino-14-hydroxy-6,13-dioctyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),8,11(15)-pentaene-5,7,12-trione |
| SMILES | CCCCCCCCn1c(O)c2cc(Nc3ccc(C(C)(C)C)cc3)c3c4c2c(c1=O)/c(=N/c1ccc(C(C)(C)C)cc1)cc-4c(=O)n(CCCCCCCC)c3=O |
| InChI | InChI=1S/C50H64N4O4/c1-9-11-13-15-17-19-29-53-45(55)37-31-40(52-36-27-23-34(24-28-36)50(6,7)8)44-42-38(46(56)54(48(44)58)30-20-18-16-14-12-10-2)32-39(43(41(37)42)47(53)57)51-35-25-21-33(22-26-35)49(3,4)5/h21-28,31-32,51,56H,9-20,29-30H2,1-8H3/b52-40+ |
| InChIKey | GDMBEVDLLSMHNI-XPZUOBEZSA-N |
| XLogP | 11.65 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.09 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|