About 7-nitro-2,1,3-benzoxadiazol-4-ol
7-nitro-2,1,3-benzoxadiazol-4-ol (PubChem CID 135485947) has the molecular formula C6H3N3O4
and a molecular weight of 181.11 g/mol. Its IUPAC name is 7-nitro-2,1,3-benzoxadiazol-4-ol.
Molecular Properties
| Compound Name | 7-nitro-2,1,3-benzoxadiazol-4-ol |
| PubChem CID | 135485947 |
| Molecular Formula | C6H3N3O4 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 7-nitro-2,1,3-benzoxadiazol-4-ol |
| SMILES | O=[N+]([O-])c1ccc(O)c2nonc12 |
| InChI | InChI=1S/C6H3N3O4/c10-4-2-1-3(9(11)12)5-6(4)8-13-7-5/h1-2,10H |
| InChIKey | KLNINKSJGOWWCU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-2,1,3-benzoxadiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-2,1,3-benzoxadiazol-4-ol?
The IUPAC name of 7-nitro-2,1,3-benzoxadiazol-4-ol (CID 135485947) is 7-nitro-2,1,3-benzoxadiazol-4-ol.
What is the SMILES notation for 7-nitro-2,1,3-benzoxadiazol-4-ol?
The canonical SMILES for 7-nitro-2,1,3-benzoxadiazol-4-ol is O=[N+]([O-])c1ccc(O)c2nonc12.
What is the InChIKey of 7-nitro-2,1,3-benzoxadiazol-4-ol?
The InChIKey is KLNINKSJGOWWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O4/c10-4-2-1-3(9(11)12)5-6(4)8-13-7-5/h1-2,10H.
What are the key properties of 7-nitro-2,1,3-benzoxadiazol-4-ol?
7-nitro-2,1,3-benzoxadiazol-4-ol has a molecular weight of 181.11 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-2,1,3-benzoxadiazol-4-ol is sourced from PubChem (CID 135485947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).