C22H16N4O2 — CID 135487346
2-[(E)-[(15-methyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-yl)hydrazinylidene]methyl]phenol (PubChem CID 135487346) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 2-[(E)-[(15-methyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(15-methyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135487346 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(E)-[(15-methyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1nc(N/N=C/c2ccccc2O)c2oc3ccc4ccccc4c3c2n1 |
| InChI | InChI=1S/C22H16N4O2/c1-13-24-20-19-16-8-4-2-6-14(16)10-11-18(19)28-21(20)22(25-13)26-23-12-15-7-3-5-9-17(15)27/h2-12,27H,1H3,(H,24,25,26)/b23-12+ |
| InChIKey | GVOOWDPWYRFRRR-FSJBWODESA-N |
| XLogP | 4.99 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|