C20H12ClN5O3S — CID 135487381
(2E,5E)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]imino]-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one (PubChem CID 135487381) has the molecular formula C20H12ClN5O3S and a molecular weight of 437.87 g/mol. Its IUPAC name is (2E,5E)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]imino]-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]imino]-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135487381 |
| Molecular Formula | C20H12ClN5O3S |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | (2E,5E)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]imino]-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C2/S/C(=N/c3nnc(-c4ccc(Cl)cc4)o3)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H12ClN5O3S/c1-26-13-5-3-2-4-12(13)14(18(26)28)15-16(27)22-20(30-15)23-19-25-24-17(29-19)10-6-8-11(21)9-7-10/h2-9H,1H3,(H,22,23,25,27)/b15-14+ |
| InChIKey | RFYHMXZFKBLJQT-CCEZHUSRSA-N |
| XLogP | 3.63 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|