C19H17N5O3S — CID 135487608
N-methyl-1-[4-[(2-oxo-3,6-dihydropyrrolo[3,2-f]quinolin-1-yl)diazenyl]phenyl]methanesulfonamide (PubChem CID 135487608) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-methyl-1-[4-[(2-oxo-3,6-dihydropyrrolo[3,2-f]quinolin-1-yl)diazenyl]phenyl]methanesulfonamide.
| Compound Name | N-methyl-1-[4-[(2-oxo-3,6-dihydropyrrolo[3,2-f]quinolin-1-yl)diazenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 135487608 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-methyl-1-[4-[(2-oxo-3,6-dihydropyrrolo[3,2-f]quinolin-1-yl)diazenyl]phenyl]methanesulfonamide |
| SMILES | CNS(=O)(=O)Cc1ccc(/N=N/c2c(=O)[nH]c3ccc4[nH]cccc4c23)cc1 |
| InChI | InChI=1S/C19H17N5O3S/c1-20-28(26,27)11-12-4-6-13(7-5-12)23-24-18-17-14-3-2-10-21-15(14)8-9-16(17)22-19(18)25/h2-10,20-21H,11H2,1H3,(H,22,25)/b24-23+ |
| InChIKey | CGAXBCXBYXWWDF-WCWDXBQESA-N |
| XLogP | 3.47 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|