C24H32N6O4 — CID 135487696
5-(5-acetyl-2-butoxy-3-pyridinyl)-3-ethyl-2-(2-morpholin-4-ylethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 135487696) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is 5-(5-acetyl-2-butoxy-3-pyridinyl)-3-ethyl-2-(2-morpholin-4-ylethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | 5-(5-acetyl-2-butoxy-3-pyridinyl)-3-ethyl-2-(2-morpholin-4-ylethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135487696 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 5-(5-acetyl-2-butoxy-3-pyridinyl)-3-ethyl-2-(2-morpholin-4-ylethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | CCCCOc1ncc(C(C)=O)cc1-c1nc2c(CC)n(CCN3CCOCC3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H32N6O4/c1-4-6-11-34-24-18(14-17(15-25-24)16(3)31)22-26-20-19(5-2)30(28-21(20)23(32)27-22)8-7-29-9-12-33-13-10-29/h14-15H,4-13H2,1-3H3,(H,26,27,32) |
| InChIKey | CNCUTWNMEWCOPN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|