About [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea
[(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea (PubChem CID 135488445) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea |
| PubChem CID | 135488445 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H9N3O2S/c9-8(14)11-10-4-5-1-2-6(12)7(13)3-5/h1-4,12-13H,(H3,9,11,14)/b10-4+ |
| InChIKey | WJUCYWPKZJPHEF-ONNFQVAWSA-N |
| XLogP | 0.26 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea?
The IUPAC name of [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea (CID 135488445) is [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea.
What is the SMILES notation for [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea?
The canonical SMILES for [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea is NC(=S)N/N=C/c1ccc(O)c(O)c1.
What is the InChIKey of [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea?
The InChIKey is WJUCYWPKZJPHEF-ONNFQVAWSA-N. The full InChI is InChI=1S/C8H9N3O2S/c9-8(14)11-10-4-5-1-2-6(12)7(13)3-5/h1-4,12-13H,(H3,9,11,14)/b10-4+.
What are the key properties of [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea?
[(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea has a molecular weight of 211.25 g/mol, XLogP of 0.26, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3,4-dihydroxyphenyl)methylideneamino]thiourea is sourced from PubChem (CID 135488445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).