C13H19ClN6O4 — CID 135488943
N',N'-diethyl-N-(7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine;hydrochloride (PubChem CID 135488943) has the molecular formula C13H19ClN6O4 and a molecular weight of 358.79 g/mol. Its IUPAC name is N',N'-diethyl-N-(7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N',N'-diethyl-N-(7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 135488943 |
| Molecular Formula | C13H19ClN6O4 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N',N'-diethyl-N-(7-nitro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine;hydrochloride |
| SMILES | CCN(CC)CCNc1n[n+]([O-])c2cc([N+](=O)[O-])ccc2[n+]1[O-].Cl |
| InChI | InChI=1S/C13H18N6O4.ClH/c1-3-16(4-2)8-7-14-13-15-18(21)12-9-10(19(22)23)5-6-11(12)17(13)20;/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,15);1H |
| InChIKey | XESIUBQYNOEKJA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|