C14H21N5O4 — CID 135489116
N-[6-(2-methoxyethoxy)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 135489116) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[6-(2-methoxyethoxy)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 135489116 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COCCOc1ccc2c(c1)[n+]([O-])c(NCCN(C)C)n[n+]2[O-] |
| InChI | InChI=1S/C14H21N5O4/c1-17(2)7-6-15-14-16-19(21)12-5-4-11(23-9-8-22-3)10-13(12)18(14)20/h4-5,10H,6-9H2,1-3H3,(H,15,16) |
| InChIKey | RZBHVVAEOHCFDO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|