C19H13N3O4 — CID 135489139
3-(3-methyl-1,2-oxazol-5-yl)-6-nitro-4-phenyl-1H-quinolin-2-one (PubChem CID 135489139) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 3-(3-methyl-1,2-oxazol-5-yl)-6-nitro-4-phenyl-1H-quinolin-2-one.
| Compound Name | 3-(3-methyl-1,2-oxazol-5-yl)-6-nitro-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135489139 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-(3-methyl-1,2-oxazol-5-yl)-6-nitro-4-phenyl-1H-quinolin-2-one |
| SMILES | Cc1cc(-c2c(-c3ccccc3)c3cc([N+](=O)[O-])ccc3[nH]c2=O)on1 |
| InChI | InChI=1S/C19H13N3O4/c1-11-9-16(26-21-11)18-17(12-5-3-2-4-6-12)14-10-13(22(24)25)7-8-15(14)20-19(18)23/h2-10H,1H3,(H,20,23) |
| InChIKey | WUODVVWLDXKMCY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|