About 2-pyridin-2-ylphenol
2-pyridin-2-ylphenol (PubChem CID 135489221) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-pyridin-2-ylphenol.
Molecular Properties
| Compound Name | 2-pyridin-2-ylphenol |
| PubChem CID | 135489221 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-pyridin-2-ylphenol |
| SMILES | Oc1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H9NO/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10/h1-8,13H |
| InChIKey | HPDNGBIRSIWOST-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylphenol?
The IUPAC name of 2-pyridin-2-ylphenol (CID 135489221) is 2-pyridin-2-ylphenol.
What is the SMILES notation for 2-pyridin-2-ylphenol?
The canonical SMILES for 2-pyridin-2-ylphenol is Oc1ccccc1-c1ccccn1.
What is the InChIKey of 2-pyridin-2-ylphenol?
The InChIKey is HPDNGBIRSIWOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10/h1-8,13H.
What are the key properties of 2-pyridin-2-ylphenol?
2-pyridin-2-ylphenol has a molecular weight of 171.20 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylphenol is sourced from PubChem (CID 135489221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).