About 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine
2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine (PubChem CID 135489582) has the molecular formula C17H26ClN3
and a molecular weight of 307.87 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine |
| PubChem CID | 135489582 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine |
| SMILES | CCN(CC)CC/N=C1\CC(c2ccc(Cl)cc2)C(C)N1 |
| InChI | InChI=1S/C17H26ClN3/c1-4-21(5-2)11-10-19-17-12-16(13(3)20-17)14-6-8-15(18)9-7-14/h6-9,13,16H,4-5,10-12H2,1-3H3,(H,19,20) |
| InChIKey | GGZXDWZUENHBNX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine?
The IUPAC name of 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine (CID 135489582) is 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine.
What is the SMILES notation for 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine?
The canonical SMILES for 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine is CCN(CC)CC/N=C1\CC(c2ccc(Cl)cc2)C(C)N1.
What is the InChIKey of 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine?
The InChIKey is GGZXDWZUENHBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClN3/c1-4-21(5-2)11-10-19-17-12-16(13(3)20-17)14-6-8-15(18)9-7-14/h6-9,13,16H,4-5,10-12H2,1-3H3,(H,19,20).
What are the key properties of 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine?
2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine has a molecular weight of 307.87 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-chlorophenyl)-5-methylpyrrolidin-2-ylidene]amino]-N,N-diethylethanamine is sourced from PubChem (CID 135489582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).