About 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one
2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one (PubChem CID 135489870) has the molecular formula C23H20N3O2P
and a molecular weight of 401.41 g/mol. Its IUPAC name is 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one |
| PubChem CID | 135489870 |
| Molecular Formula | C23H20N3O2P |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one |
| SMILES | COc1nc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C23H20N3O2P/c1-28-23-24-21(17-22(27)25-23)26-29(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3,(H,24,25,27) |
| InChIKey | NLIDPNHAYRHPQA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one?
The IUPAC name of 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one (CID 135489870) is 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one is COc1nc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc(=O)[nH]1.
What is the InChIKey of 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one?
The InChIKey is NLIDPNHAYRHPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N3O2P/c1-28-23-24-21(17-22(27)25-23)26-29(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3,(H,24,25,27).
What are the key properties of 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one?
2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one has a molecular weight of 401.41 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-[(triphenyl-λ5-phosphanylidene)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 135489870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).