C14H20O4 — CID 1354900
trans-(1S,2S,4E)-4-(4-methylpent-3-enylidene)cyclohexane-1,2-dicarboxylic acid (PubChem CID 1354900) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is trans-(1S,2S,4E)-4-(4-methylpent-3-enylidene)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | trans-(1S,2S,4E)-4-(4-methylpent-3-enylidene)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 1354900 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | trans-(1S,2S,4E)-4-(4-methylpent-3-enylidene)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CC(C)=CC/C=C1\CC[C@H](C(=O)O)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H20O4/c1-9(2)4-3-5-10-6-7-11(13(15)16)12(8-10)14(17)18/h4-5,11-12H,3,6-8H2,1-2H3,(H,15,16)(H,17,18)/b10-5+/t11-,12-/m0/s1 |
| InChIKey | HDZCYWICCGGCST-AMYKANGRSA-N |
| XLogP | 2.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|