About tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate
tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate (PubChem CID 135490875) has the molecular formula C15H27N3O5
and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate |
| PubChem CID | 135490875 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)/C(=N\OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O5/c1-9-10-18(13(20)23-15(5,6)7)11(17-21-8)16-12(19)22-14(2,3)4/h9H,1,10H2,2-8H3,(H,16,17,19) |
| InChIKey | FJSOVRBOCTWCRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate?
The IUPAC name of tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate (CID 135490875) is tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate.
What is the SMILES notation for tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate?
The canonical SMILES for tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate is C=CCN(C(=O)OC(C)(C)C)/C(=N\OC)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate?
The InChIKey is FJSOVRBOCTWCRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O5/c1-9-10-18(13(20)23-15(5,6)7)11(17-21-8)16-12(19)22-14(2,3)4/h9H,1,10H2,2-8H3,(H,16,17,19).
What are the key properties of tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate?
tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate has a molecular weight of 329.40 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-N'-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-prop-2-enylcarbamate is sourced from PubChem (CID 135490875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).