About ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate
ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate (PubChem CID 135491546) has the molecular formula C13H10N2O4S
and a molecular weight of 290.30 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate |
| PubChem CID | 135491546 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)nc2sc3ccccc3n2c1=O |
| InChI | InChI=1S/C13H10N2O4S/c1-2-19-12(18)9-10(16)14-13-15(11(9)17)7-5-3-4-6-8(7)20-13/h3-6,16H,2H2,1H3 |
| InChIKey | MRFUMAXEOOVHTP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The IUPAC name of ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate (CID 135491546) is ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate.
What is the SMILES notation for ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The canonical SMILES for ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate is CCOC(=O)c1c(O)nc2sc3ccccc3n2c1=O.
What is the InChIKey of ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The InChIKey is MRFUMAXEOOVHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4S/c1-2-19-12(18)9-10(16)14-13-15(11(9)17)7-5-3-4-6-8(7)20-13/h3-6,16H,2H2,1H3.
What are the key properties of ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate has a molecular weight of 290.30 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate is sourced from PubChem (CID 135491546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).