About 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one
3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one (PubChem CID 135491552) has the molecular formula C31H27NO3S
and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one |
| PubChem CID | 135491552 |
| Molecular Formula | C31H27NO3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one |
| SMILES | CCCCCCc1cc2cc(-c3nc(-c4ccc5c(c4)Cc4ccccc4-5)cs3)c(=O)oc2cc1O |
| InChI | InChI=1S/C31H27NO3S/c1-2-3-4-5-9-21-15-23-16-26(31(34)35-29(23)17-28(21)33)30-32-27(18-36-30)20-11-12-25-22(14-20)13-19-8-6-7-10-24(19)25/h6-8,10-12,14-18,33H,2-5,9,13H2,1H3 |
| InChIKey | XEHVAUNUJXZRJR-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one?
The IUPAC name of 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one (CID 135491552) is 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one.
What is the SMILES notation for 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one?
The canonical SMILES for 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one is CCCCCCc1cc2cc(-c3nc(-c4ccc5c(c4)Cc4ccccc4-5)cs3)c(=O)oc2cc1O.
What is the InChIKey of 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one?
The InChIKey is XEHVAUNUJXZRJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27NO3S/c1-2-3-4-5-9-21-15-23-16-26(31(34)35-29(23)17-28(21)33)30-32-27(18-36-30)20-11-12-25-22(14-20)13-19-8-6-7-10-24(19)25/h6-8,10-12,14-18,33H,2-5,9,13H2,1H3.
What are the key properties of 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one?
3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one has a molecular weight of 493.63 g/mol, XLogP of 7.98, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-6-hexyl-7-hydroxychromen-2-one is sourced from PubChem (CID 135491552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).