About 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol
5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol (PubChem CID 135492326) has the molecular formula C6H2N4O7
and a molecular weight of 242.10 g/mol. Its IUPAC name is 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol.
Molecular Properties
| Compound Name | 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol |
| PubChem CID | 135492326 |
| Molecular Formula | C6H2N4O7 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2no[n+]([O-])c2c1O |
| InChI | InChI=1S/C6H2N4O7/c11-6-3(9(14)15)1-2(8(12)13)4-5(6)10(16)17-7-4/h1,11H |
| InChIKey | QQUHPUBORFQPNZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol?
The IUPAC name of 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol (CID 135492326) is 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol.
What is the SMILES notation for 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol?
The canonical SMILES for 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol is O=[N+]([O-])c1cc([N+](=O)[O-])c2no[n+]([O-])c2c1O.
What is the InChIKey of 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol?
The InChIKey is QQUHPUBORFQPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N4O7/c11-6-3(9(14)15)1-2(8(12)13)4-5(6)10(16)17-7-4/h1,11H.
What are the key properties of 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol?
5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol has a molecular weight of 242.10 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium-4-ol is sourced from PubChem (CID 135492326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).