About palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol)
palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) (PubChem CID 135492910) has the molecular formula C22H18N6O4Pd
and a molecular weight of 536.84 g/mol. Its IUPAC name is palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol).
Molecular Properties
| Compound Name | palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) |
| PubChem CID | 135492910 |
| Molecular Formula | C22H18N6O4Pd |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) |
| SMILES | Oc1ccc(/N=N/c2ccccn2)c(O)c1.Oc1ccc(/N=N/c2ccccn2)c(O)c1.[Pd] |
| InChI | InChI=1S/2C11H9N3O2.Pd/c2*15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h2*1-7,15-16H;/b2*14-13+; |
| InChIKey | JRLKXQNVINLHGI-FZHLCEHXSA-N |
| XLogP | 5.81 |
| TPSA | 156.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol)?
The IUPAC name of palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) (CID 135492910) is palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol).
What is the SMILES notation for palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol)?
The canonical SMILES for palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) is Oc1ccc(/N=N/c2ccccn2)c(O)c1.Oc1ccc(/N=N/c2ccccn2)c(O)c1.[Pd].
What is the InChIKey of palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol)?
The InChIKey is JRLKXQNVINLHGI-FZHLCEHXSA-N. The full InChI is InChI=1S/2C11H9N3O2.Pd/c2*15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h2*1-7,15-16H;/b2*14-13+;.
What are the key properties of palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol)?
palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) has a molecular weight of 536.84 g/mol, XLogP of 5.81, 4 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(4-(pyridin-2-yldiazenyl)benzene-1,3-diol) is sourced from PubChem (CID 135492910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).