C16H20ClN5O8 — CID 135493621
ethyl 2-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-[(E)-(pyrimidin-2-ylhydrazinylidene)methyl]pyridin-1-ium-1-yl]acetate perchlorate (PubChem CID 135493621) has the molecular formula C16H20ClN5O8 and a molecular weight of 445.82 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-[(E)-(pyrimidin-2-ylhydrazinylidene)methyl]pyridin-1-ium-1-yl]acetate perchlorate.
| Compound Name | ethyl 2-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-[(E)-(pyrimidin-2-ylhydrazinylidene)methyl]pyridin-1-ium-1-yl]acetate perchlorate |
|---|---|
| PubChem CID | 135493621 |
| Molecular Formula | C16H20ClN5O8 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | ethyl 2-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-[(E)-(pyrimidin-2-ylhydrazinylidene)methyl]pyridin-1-ium-1-yl]acetate perchlorate |
| SMILES | CCOC(=O)C[n+]1cc(CO)c(/C=N/Nc2ncccn2)c(O)c1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H19N5O4.ClHO4/c1-3-25-14(23)9-21-8-12(10-22)13(15(24)11(21)2)7-19-20-16-17-5-4-6-18-16;2-1(3,4)5/h4-8,22,24H,3,9-10H2,1-2H3;(H,2,3,4,5) |
| InChIKey | QYWXCJDZNOWEHU-UHFFFAOYSA-N |
| XLogP | -4.48 |
| TPSA | 213.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|