About N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide
N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide (PubChem CID 135493697) has the molecular formula C17H8F2N2O2
and a molecular weight of 310.26 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide |
| PubChem CID | 135493697 |
| Molecular Formula | C17H8F2N2O2 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N\c1ccc(F)cc1F)C1=C(O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H8F2N2O2/c18-9-5-6-13(12(19)7-9)21-14(8-20)15-16(22)10-3-1-2-4-11(10)17(15)23/h1-7,22H/b21-14+ |
| InChIKey | WSTCWYLXCGNZDW-KGENOOAVSA-N |
| XLogP | 3.73 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide?
The IUPAC name of N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide (CID 135493697) is N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide.
What is the SMILES notation for N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide?
The canonical SMILES for N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide is N#C/C(=N\c1ccc(F)cc1F)C1=C(O)c2ccccc2C1=O.
What is the InChIKey of N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide?
The InChIKey is WSTCWYLXCGNZDW-KGENOOAVSA-N. The full InChI is InChI=1S/C17H8F2N2O2/c18-9-5-6-13(12(19)7-9)21-14(8-20)15-16(22)10-3-1-2-4-11(10)17(15)23/h1-7,22H/b21-14+.
What are the key properties of N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide?
N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide has a molecular weight of 310.26 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide is sourced from PubChem (CID 135493697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).