C20H23ClN4O — CID 135494234
(NE)-N-[1-[7-(4-chloro-2,6-dimethylphenyl)-2,5,6-trimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine (PubChem CID 135494234) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is (NE)-N-[1-[7-(4-chloro-2,6-dimethylphenyl)-2,5,6-trimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[7-(4-chloro-2,6-dimethylphenyl)-2,5,6-trimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 135494234 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (NE)-N-[1-[7-(4-chloro-2,6-dimethylphenyl)-2,5,6-trimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine |
| SMILES | CC/C(=N\O)c1nc(C)nc2c1c(C)c(C)n2-c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C20H23ClN4O/c1-7-16(24-26)18-17-12(4)13(5)25(20(17)23-14(6)22-18)19-10(2)8-15(21)9-11(19)3/h8-9,26H,7H2,1-6H3/b24-16+ |
| InChIKey | LQMYTNDZYUDWDG-LFVJCYFKSA-N |
| XLogP | 5.20 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|