C19H14ClN5O2 — CID 135494361
5-(2-chlorophenyl)-3-cyclopropyl-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine (PubChem CID 135494361) has the molecular formula C19H14ClN5O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-cyclopropyl-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine.
| Compound Name | 5-(2-chlorophenyl)-3-cyclopropyl-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 135494361 |
| Molecular Formula | C19H14ClN5O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-(2-chlorophenyl)-3-cyclopropyl-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1ccccc1Cl)=Nc1c(n[nH]c1C1CC1)N2 |
| InChI | InChI=1S/C19H14ClN5O2/c20-14-4-2-1-3-12(14)17-13-9-11(25(26)27)7-8-15(13)21-19-18(22-17)16(23-24-19)10-5-6-10/h1-4,7-10H,5-6H2,(H2,21,23,24) |
| InChIKey | AVXKZBUGHPGGBG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|