C46H30N4O2 — CID 135494440
4-[15-(4-formylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 135494440) has the molecular formula C46H30N4O2 and a molecular weight of 670.77 g/mol. Its IUPAC name is 4-[15-(4-formylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(4-formylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 135494440 |
| Molecular Formula | C46H30N4O2 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | 4-[15-(4-formylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccc(C=O)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H30N4O2/c51-27-29-11-15-33(16-12-29)45-39-23-19-35(47-39)43(31-7-3-1-4-8-31)36-20-24-40(48-36)46(34-17-13-30(28-52)14-18-34)42-26-22-38(50-42)44(32-9-5-2-6-10-32)37-21-25-41(45)49-37/h1-28,47,50H/b43-35-,43-36-,44-37-,44-38-,45-39-,45-41-,46-40-,46-42- |
| InChIKey | CVKBMQCHWDJMAJ-ZTRVSJDYSA-N |
| XLogP | 10.95 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|