About 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide
2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide (PubChem CID 135495015) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide.
Molecular Properties
| Compound Name | 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide |
| PubChem CID | 135495015 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide |
| SMILES | CC(=O)C(=C(C)O)/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-13(21)17(14(2)22)18(19-15-9-5-3-6-10-15)20-16-11-7-4-8-12-16/h3-12,21H,1-2H3,(H,19,20) |
| InChIKey | KTWGQZMPYIGHJI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide?
The IUPAC name of 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide (CID 135495015) is 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide.
What is the SMILES notation for 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide?
The canonical SMILES for 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide is CC(=O)C(=C(C)O)/C(=N\c1ccccc1)Nc1ccccc1.
What is the InChIKey of 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide?
The InChIKey is KTWGQZMPYIGHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-13(21)17(14(2)22)18(19-15-9-5-3-6-10-15)20-16-11-7-4-8-12-16/h3-12,21H,1-2H3,(H,19,20).
What are the key properties of 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide?
2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide has a molecular weight of 294.35 g/mol, XLogP of 4.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-hydroxy-N,N'-diphenylbut-2-enimidamide is sourced from PubChem (CID 135495015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).