About methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate
methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 135495531) has the molecular formula C20H15NO5S
and a molecular weight of 381.41 g/mol. Its IUPAC name is methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| PubChem CID | 135495531 |
| Molecular Formula | C20H15NO5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C\c2ccc3c(c2)OCO3)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H15NO5S/c1-24-20(23)17-18(22)16(27-19(17)21-13-5-3-2-4-6-13)10-12-7-8-14-15(9-12)26-11-25-14/h2-10,22H,11H2,1H3/b16-10+,21-19- |
| InChIKey | DZUIOLPQWWSQLA-JSDDMWTDSA-N |
| XLogP | 4.22 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate?
The IUPAC name of methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate (CID 135495531) is methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
What is the SMILES notation for methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate?
The canonical SMILES for methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate is COC(=O)C1=C(O)/C(=C\c2ccc3c(c2)OCO3)S/C1=N\c1ccccc1.
What is the InChIKey of methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate?
The InChIKey is DZUIOLPQWWSQLA-JSDDMWTDSA-N. The full InChI is InChI=1S/C20H15NO5S/c1-24-20(23)17-18(22)16(27-19(17)21-13-5-3-2-4-6-13)10-12-7-8-14-15(9-12)26-11-25-14/h2-10,22H,11H2,1H3/b16-10+,21-19-.
What are the key properties of methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate?
methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate has a molecular weight of 381.41 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-phenyliminothiophene-3-carboxylate is sourced from PubChem (CID 135495531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).