C20H23N5O2S — CID 135495535
4-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135495535) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135495535 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCN(CC)c1ccc(/C=N/n2c(COc3ccccc3)n[nH]c2=S)c(O)c1 |
| InChI | InChI=1S/C20H23N5O2S/c1-3-24(4-2)16-11-10-15(18(26)12-16)13-21-25-19(22-23-20(25)28)14-27-17-8-6-5-7-9-17/h5-13,26H,3-4,14H2,1-2H3,(H,23,28)/b21-13+ |
| InChIKey | HBXPTBFGQWUKLC-FYJGNVAPSA-N |
| XLogP | 3.95 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|