C10H16N4O6 — CID 135496317
4-amino-2-methoxy-5-[[(2S,3R,4S)-2,3,4,5-tetrahydroxypentylidene]amino]-1H-pyrimidin-6-one (PubChem CID 135496317) has the molecular formula C10H16N4O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-amino-2-methoxy-5-[[(2S,3R,4S)-2,3,4,5-tetrahydroxypentylidene]amino]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-methoxy-5-[[(2S,3R,4S)-2,3,4,5-tetrahydroxypentylidene]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135496317 |
| Molecular Formula | C10H16N4O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-amino-2-methoxy-5-[[(2S,3R,4S)-2,3,4,5-tetrahydroxypentylidene]amino]-1H-pyrimidin-6-one |
| SMILES | COc1nc(N)c(/N=C/[C@H](O)[C@@H](O)[C@@H](O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N4O6/c1-20-10-13-8(11)6(9(19)14-10)12-2-4(16)7(18)5(17)3-15/h2,4-5,7,15-18H,3H2,1H3,(H3,11,13,14,19)/b12-2+/t4-,5-,7+/m0/s1 |
| InChIKey | NYQQLJJSUYZMRQ-STWKIVAQSA-N |
| XLogP | -2.86 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|