About 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one
6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one (PubChem CID 135496612) has the molecular formula C20H17BrN4O2
and a molecular weight of 425.29 g/mol. Its IUPAC name is 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
| PubChem CID | 135496612 |
| Molecular Formula | C20H17BrN4O2 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
| SMILES | [H]/N=C1/C(c2nc3ccc(Br)cc3c(=O)[nH]2)=C(O)CN1c1cccc(C)c1C |
| InChI | InChI=1S/C20H17BrN4O2/c1-10-4-3-5-15(11(10)2)25-9-16(26)17(18(25)22)19-23-14-7-6-12(21)8-13(14)20(27)24-19/h3-8,22,26H,9H2,1-2H3,(H,23,24,27)/b22-18- |
| InChIKey | RLEKWWPHIVCYBA-PYCFMQQDSA-N |
| XLogP | 4.07 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one?
The IUPAC name of 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one (CID 135496612) is 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one.
What is the SMILES notation for 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one?
The canonical SMILES for 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one is [H]/N=C1/C(c2nc3ccc(Br)cc3c(=O)[nH]2)=C(O)CN1c1cccc(C)c1C.
What is the InChIKey of 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one?
The InChIKey is RLEKWWPHIVCYBA-PYCFMQQDSA-N. The full InChI is InChI=1S/C20H17BrN4O2/c1-10-4-3-5-15(11(10)2)25-9-16(26)17(18(25)22)19-23-14-7-6-12(21)8-13(14)20(27)24-19/h3-8,22,26H,9H2,1-2H3,(H,23,24,27)/b22-18-.
What are the key properties of 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one?
6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one has a molecular weight of 425.29 g/mol, XLogP of 4.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[1-(2,3-dimethylphenyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one is sourced from PubChem (CID 135496612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).