C48H30N4O4 — CID 135496651
4-[10,15,20-tris(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 135496651) has the molecular formula C48H30N4O4 and a molecular weight of 726.79 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[10,15,20-tris(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 135496651 |
| Molecular Formula | C48H30N4O4 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | 4-[10,15,20-tris(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2c3nc(c(-c4ccc(C=O)cc4)c4ccc([nH]4)c(-c4ccc(C=O)cc4)c4nc(c(-c5ccc(C=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H30N4O4/c53-25-29-1-9-33(10-2-29)45-37-17-19-39(49-37)46(34-11-3-30(26-54)4-12-34)41-21-23-43(51-41)48(36-15-7-32(28-56)8-16-36)44-24-22-42(52-44)47(40-20-18-38(45)50-40)35-13-5-31(27-55)6-14-35/h1-28,49,52H/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | LKNZAROPNWYSST-PJEPRTEXSA-N |
| XLogP | 10.57 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|