About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate (PubChem CID 135497048) has the molecular formula C11H16N6O6
and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate |
| PubChem CID | 135497048 |
| Molecular Formula | C11H16N6O6 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)CCC(=O)N/C(N)=N\O |
| InChI | InChI=1S/C11H16N6O6/c1-7-13-6-9(17(21)22)16(7)4-5-23-10(19)3-2-8(18)14-11(12)15-20/h6,20H,2-5H2,1H3,(H3,12,14,15,18) |
| InChIKey | FJGUZCHAUIGGAL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate (CID 135497048) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)CCC(=O)N/C(N)=N\O.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate?
The InChIKey is FJGUZCHAUIGGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O6/c1-7-13-6-9(17(21)22)16(7)4-5-23-10(19)3-2-8(18)14-11(12)15-20/h6,20H,2-5H2,1H3,(H3,12,14,15,18).
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate has a molecular weight of 328.29 g/mol, XLogP of -0.76, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[(Z)-N'-hydroxycarbamimidoyl]amino]-4-oxobutanoate is sourced from PubChem (CID 135497048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).