C33H27N5O2S — CID 135497512
N-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-2-ylidene]-4-methyl-N'-phenylbenzenecarboximidamide (PubChem CID 135497512) has the molecular formula C33H27N5O2S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-2-ylidene]-4-methyl-N'-phenylbenzenecarboximidamide.
| Compound Name | N-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-2-ylidene]-4-methyl-N'-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 135497512 |
| Molecular Formula | C33H27N5O2S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-2-ylidene]-4-methyl-N'-phenylbenzenecarboximidamide |
| SMILES | COc1ccc(-n2/c(=N/C(=N/c3ccccc3)c3ccc(C)cc3)sc3c(=O)[nH]c(-c4ccc(C)cc4)nc32)cc1 |
| InChI | InChI=1S/C33H27N5O2S/c1-21-9-13-23(14-10-21)29(34-25-7-5-4-6-8-25)37-33-38(26-17-19-27(40-3)20-18-26)31-28(41-33)32(39)36-30(35-31)24-15-11-22(2)12-16-24/h4-20H,1-3H3,(H,35,36,39)/b34-29+,37-33- |
| InChIKey | JKMDDDXFHFNAAZ-RGBXBKJASA-N |
| XLogP | 6.75 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|