About Mirodenafil
Mirodenafil (PubChem CID 135497803) has the molecular formula C26H37N5O5S
and a molecular weight of 531.70 g/mol. Its IUPAC name is 5-ethyl-2-[5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonyl-2-propoxyphenyl]-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | Mirodenafil |
| PubChem CID | 135497803 |
| Molecular Formula | C26H37N5O5S |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 5-ethyl-2-[5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonyl-2-propoxyphenyl]-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCCC1=CN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCO)OCCC)CC |
| InChI | InChI=1S/C26H37N5O5S/c1-4-7-19-18-30(6-3)24-23(19)27-25(28-26(24)33)21-17-20(8-9-22(21)36-16-5-2)37(34,35)31-12-10-29(11-13-31)14-15-32/h8-9,17-18,32H,4-7,10-16H2,1-3H3,(H,27,28,33) |
| InChIKey | MIJFNYMSCFYZNY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | 902 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Mirodenafil with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mirodenafil?
The IUPAC name of Mirodenafil (CID 135497803) is 5-ethyl-2-[5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonyl-2-propoxyphenyl]-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for Mirodenafil?
The canonical SMILES for Mirodenafil is CCCC1=CN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCO)OCCC)CC.
What is the InChIKey of Mirodenafil?
The InChIKey is MIJFNYMSCFYZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37N5O5S/c1-4-7-19-18-30(6-3)24-23(19)27-25(28-26(24)33)21-17-20(8-9-22(21)36-16-5-2)37(34,35)31-12-10-29(11-13-31)14-15-32/h8-9,17-18,32H,4-7,10-16H2,1-3H3,(H,27,28,33).
What are the key properties of Mirodenafil?
Mirodenafil has a molecular weight of 531.70 g/mol, XLogP of 2.20, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Mirodenafil is sourced from PubChem (CID 135497803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).