C22H18ClNO6S — CID 135498096
2-[2-[(Z)-[5-(4-chlorophenyl)imino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene]methyl]phenoxy]acetic acid (PubChem CID 135498096) has the molecular formula C22H18ClNO6S and a molecular weight of 459.91 g/mol. Its IUPAC name is 2-[2-[(Z)-[5-(4-chlorophenyl)imino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[5-(4-chlorophenyl)imino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135498096 |
| Molecular Formula | C22H18ClNO6S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-[2-[(Z)-[5-(4-chlorophenyl)imino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccccc2OCC(=O)O)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO6S/c1-2-29-22(28)19-20(27)17(31-21(19)24-15-9-7-14(23)8-10-15)11-13-5-3-4-6-16(13)30-12-18(25)26/h3-11,27H,2,12H2,1H3,(H,25,26)/b17-11-,24-21- |
| InChIKey | HKYNURTWWQZMJB-NNIDOINMSA-N |
| XLogP | 5.00 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|