C17H17N5O4S2 — CID 135498540
N,N-dimethyl-3-[[5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzenesulfonamide (PubChem CID 135498540) has the molecular formula C17H17N5O4S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is N,N-dimethyl-3-[[5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135498540 |
| Molecular Formula | C17H17N5O4S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N,N-dimethyl-3-[[5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(/N=C2/NN=C(c3cccc([N+](=O)[O-])c3)CS2)c1 |
| InChI | InChI=1S/C17H17N5O4S2/c1-21(2)28(25,26)15-8-4-6-13(10-15)18-17-20-19-16(11-27-17)12-5-3-7-14(9-12)22(23)24/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | JYZMCSULVWIQFP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|