About ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate
ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate (PubChem CID 135499139) has the molecular formula C17H25N3OS
and a molecular weight of 319.47 g/mol. Its IUPAC name is ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate.
Molecular Properties
| Compound Name | ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate |
| PubChem CID | 135499139 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate |
| SMILES | C=CCN/C(=N/CCC1CNc2ccc(OC)cc21)SCC |
| InChI | InChI=1S/C17H25N3OS/c1-4-9-18-17(22-5-2)19-10-8-13-12-20-16-7-6-14(21-3)11-15(13)16/h4,6-7,11,13,20H,1,5,8-10,12H2,2-3H3,(H,18,19) |
| InChIKey | HYWFDMUHKKLVGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate?
The IUPAC name of ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate (CID 135499139) is ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate.
What is the SMILES notation for ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate?
The canonical SMILES for ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate is C=CCN/C(=N/CCC1CNc2ccc(OC)cc21)SCC.
What is the InChIKey of ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate?
The InChIKey is HYWFDMUHKKLVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3OS/c1-4-9-18-17(22-5-2)19-10-8-13-12-20-16-7-6-14(21-3)11-15(13)16/h4,6-7,11,13,20H,1,5,8-10,12H2,2-3H3,(H,18,19).
What are the key properties of ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate?
ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate has a molecular weight of 319.47 g/mol, XLogP of 3.48, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]-N-prop-2-enylcarbamimidothioate is sourced from PubChem (CID 135499139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).