About 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one
7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one (PubChem CID 135499263) has the molecular formula C16H11Cl3N4O2
and a molecular weight of 397.65 g/mol. Its IUPAC name is 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one |
| PubChem CID | 135499263 |
| Molecular Formula | C16H11Cl3N4O2 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one |
| SMILES | N/N=C(\c1nc2ccc(Cl)cc2[nH]c1=O)C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl3N4O2/c17-8-2-4-11-12(6-8)22-16(25)14(21-11)13(23-20)15(24)7-1-3-9(18)10(19)5-7/h1-6,15,24H,20H2,(H,22,25)/b23-13+ |
| InChIKey | UTKNKVOJGQJRON-YDZHTSKRSA-N |
| XLogP | 3.28 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one?
The IUPAC name of 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one (CID 135499263) is 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one.
What is the SMILES notation for 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one?
The canonical SMILES for 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one is N/N=C(\c1nc2ccc(Cl)cc2[nH]c1=O)C(O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one?
The InChIKey is UTKNKVOJGQJRON-YDZHTSKRSA-N. The full InChI is InChI=1S/C16H11Cl3N4O2/c17-8-2-4-11-12(6-8)22-16(25)14(21-11)13(23-20)15(24)7-1-3-9(18)10(19)5-7/h1-6,15,24H,20H2,(H,22,25)/b23-13+.
What are the key properties of 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one?
7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one has a molecular weight of 397.65 g/mol, XLogP of 3.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-[2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-1H-quinoxalin-2-one is sourced from PubChem (CID 135499263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).