C16H19N7O2S — CID 135499276
2-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-hydroxyphenyl)prop-2-enylidene]amino]guanidine (PubChem CID 135499276) has the molecular formula C16H19N7O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-hydroxyphenyl)prop-2-enylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-hydroxyphenyl)prop-2-enylidene]amino]guanidine |
|---|---|
| PubChem CID | 135499276 |
| Molecular Formula | C16H19N7O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-hydroxyphenyl)prop-2-enylidene]amino]guanidine |
| SMILES | CC(=O)NNc1nc(C)c(C(/C=C/c2ccccc2O)=N/N=C(N)N)s1 |
| InChI | InChI=1S/C16H19N7O2S/c1-9-14(26-16(19-9)23-20-10(2)24)12(21-22-15(17)18)8-7-11-5-3-4-6-13(11)25/h3-8,25H,1-2H3,(H,19,23)(H,20,24)(H4,17,18,22)/b8-7+,21-12+ |
| InChIKey | NTLVAKQUJICNDB-LRWKZWCDSA-N |
| XLogP | 1.31 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|