C13H19N3O6S — CID 135499446
diethyl (E)-2-[(E)-acetamidocarbamothioyliminomethyl]-3-hydroxypent-2-enedioate (PubChem CID 135499446) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is diethyl (E)-2-[(E)-acetamidocarbamothioyliminomethyl]-3-hydroxypent-2-enedioate.
| Compound Name | diethyl (E)-2-[(E)-acetamidocarbamothioyliminomethyl]-3-hydroxypent-2-enedioate |
|---|---|
| PubChem CID | 135499446 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | diethyl (E)-2-[(E)-acetamidocarbamothioyliminomethyl]-3-hydroxypent-2-enedioate |
| SMILES | CCOC(=O)C/C(O)=C(/C=N/C(=S)NNC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C13H19N3O6S/c1-4-21-11(19)6-10(18)9(12(20)22-5-2)7-14-13(23)16-15-8(3)17/h7,18H,4-6H2,1-3H3,(H,15,17)(H,16,23)/b10-9+,14-7+ |
| InChIKey | CMKJLZLDPSXKKT-KHXSGPMKSA-N |
| XLogP | 0.31 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|