C16H10Cl3N3O — CID 135499613
(5Z)-5-[(2-chlorophenyl)methylidene]-2-(2,4-dichlorophenyl)iminoimidazolidin-4-one (PubChem CID 135499613) has the molecular formula C16H10Cl3N3O and a molecular weight of 366.64 g/mol. Its IUPAC name is (5Z)-5-[(2-chlorophenyl)methylidene]-2-(2,4-dichlorophenyl)iminoimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-chlorophenyl)methylidene]-2-(2,4-dichlorophenyl)iminoimidazolidin-4-one |
|---|---|
| PubChem CID | 135499613 |
| Molecular Formula | C16H10Cl3N3O |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | (5Z)-5-[(2-chlorophenyl)methylidene]-2-(2,4-dichlorophenyl)iminoimidazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2Cl)N/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C16H10Cl3N3O/c17-10-5-6-13(12(19)8-10)20-16-21-14(15(23)22-16)7-9-3-1-2-4-11(9)18/h1-8H,(H2,20,21,22,23)/b14-7- |
| InChIKey | WARYICIUDNBQRI-AUWJEWJLSA-N |
| XLogP | 4.39 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|