C56H68N4O3 — CID 135499726
(1Z)-1-[5,15-bis(3,5-ditert-butylphenyl)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-8,24-dihydro-7H-porphyrin-2-ylidene]ethanol (PubChem CID 135499726) has the molecular formula C56H68N4O3 and a molecular weight of 845.18 g/mol. Its IUPAC name is (1Z)-1-[5,15-bis(3,5-ditert-butylphenyl)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-8,24-dihydro-7H-porphyrin-2-ylidene]ethanol.
| Compound Name | (1Z)-1-[5,15-bis(3,5-ditert-butylphenyl)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-8,24-dihydro-7H-porphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 135499726 |
| Molecular Formula | C56H68N4O3 |
| Molecular Weight | 845.18 g/mol |
| Exact Mass | 844.53 |
| IUPAC Name | (1Z)-1-[5,15-bis(3,5-ditert-butylphenyl)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-8,24-dihydro-7H-porphyrin-2-ylidene]ethanol |
| SMILES | C/C(O)=C1\C=C2N=C1/C=c1/cc/c([nH]1)=C(\c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C1=N/C(=C(/C3OCC(C)(C)CO3)C3=N/C(=C\2c2cc(C(C)(C)C)cc(C(C)(C)C)c2)CC3)C=C1 |
| InChI | InChI=1S/C56H68N4O3/c1-32(61)40-29-47-49(34-24-37(54(8,9)10)27-38(25-34)55(11,12)13)43-19-21-45(59-43)50(51-62-30-56(14,15)31-63-51)44-20-18-42(58-44)48(41-17-16-39(57-41)28-46(40)60-47)33-22-35(52(2,3)4)26-36(23-33)53(5,6)7/h16-18,20,22-29,51,57,61H,19,21,30-31H2,1-15H3/b39-28-,40-32-,48-41-,49-43-,50-44+ |
| InChIKey | COMMJTDCODWMHW-QKUAXSKPSA-N |
| XLogP | 11.68 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.18 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|