About 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one
1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one (PubChem CID 135499784) has the molecular formula C16H13N3OS
and a molecular weight of 295.37 g/mol. Its IUPAC name is 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one |
| PubChem CID | 135499784 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one |
| SMILES | CCC(=O)c1ccc2[nH]c(-c3n[nH]c4ccsc34)cc2c1 |
| InChI | InChI=1S/C16H13N3OS/c1-2-14(20)9-3-4-11-10(7-9)8-13(17-11)15-16-12(18-19-15)5-6-21-16/h3-8,17H,2H2,1H3,(H,18,19) |
| InChIKey | QTSVIJNUFJFMMT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one?
The IUPAC name of 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one (CID 135499784) is 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one.
What is the SMILES notation for 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one?
The canonical SMILES for 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one is CCC(=O)c1ccc2[nH]c(-c3n[nH]c4ccsc34)cc2c1.
What is the InChIKey of 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one?
The InChIKey is QTSVIJNUFJFMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3OS/c1-2-14(20)9-3-4-11-10(7-9)8-13(17-11)15-16-12(18-19-15)5-6-21-16/h3-8,17H,2H2,1H3,(H,18,19).
What are the key properties of 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one?
1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one has a molecular weight of 295.37 g/mol, XLogP of 4.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-5-yl]propan-1-one is sourced from PubChem (CID 135499784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).